cas: 1255574-35-6 — see every product listed under this CAS number, including other names
Methyl 3-bromo-5-isobutoxybenzoate 97% (CAS 1255574-35-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A272545-250mg |
| cas | 1255574-35-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 948.88 Pln | |
| Ambeed | 10g | 1594.12 Pln | |
| Ambeed | 25g | 2712.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A272545 |
Methyl 3-bromo-5-(2-methylpropoxy)benzoate (CAS 1255574-35-6) is a chemical compound with the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. IUPAC name: methyl 3-bromo-5-(2-methylpropoxy)benzoate. InChIKey: ILWDNEOAPBNDPA-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO3 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | methyl 3-bromo-5-(2-methylpropoxy)benzoate |
| InChIKey | ILWDNEOAPBNDPA-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC(=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)