cas: 234082-16-7 — see every product listed under this CAS number, including other names
Methyl 3-chloro-4-(piperazin-1-yl)benzoate (CAS 234082-16-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F772106-100MG |
| cas | 234082-16-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 664.37 Pln | |
| Fluorochem | 1g | 1575.50 Pln | |
| Fluorochem | 5g | 4199.58 Pln | |
| Fluorochem | 10g | 5438.73 Pln | |
| Fluorochem | 25g | 10312.01 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-chloro-4-piperazin-1-ylbenzoate (CAS 234082-16-7) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: methyl 3-chloro-4-piperazin-1-ylbenzoate. InChIKey: YXNWWDUBAHLVBO-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl 3-chloro-4-piperazin-1-ylbenzoate |
| InChIKey | YXNWWDUBAHLVBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N2CCNCC2)Cl |
Computed by PubChem (NCBI)