cas: 1396554-42-9 — see every product listed under this CAS number, including other names
Methyl 3-chloroimidazo[1,2-a]pyridine-7-carboxylate, 97%, 97% (CAS 1396554-42-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112BG5-100mg |
| cas | 1396554-42-9 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1158.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-chloroimidazo[1,2-a]pyridine-7-carboxylate (CAS 1396554-42-9) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: methyl 3-chloroimidazo[1,2-a]pyridine-7-carboxylate. InChIKey: YGAVUWXJDVMPEI-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | methyl 3-chloroimidazo[1,2-a]pyridine-7-carboxylate |
| InChIKey | YGAVUWXJDVMPEI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=NC=C(N2C=C1)Cl |
Computed by PubChem (NCBI)