cas: 1016979-31-9 — see every product listed under this CAS number, including other names
Methyl 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%, 98% (CAS 1016979-31-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11168Z-1g |
| cas | 1016979-31-9 |
| size | 1g |
| availability | 9.84g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 582.80 Pln | |
| Chemat | 5g | 1629.20 Pln | |
| Chemat | 250mg | 213.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1016979-31-9) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: methyl 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: GAMWSJVNEMEOFP-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | methyl 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | GAMWSJVNEMEOFP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)C(=O)OC |
Computed by PubChem (NCBI)