cas: 29427-70-1 — see every product listed under this CAS number, including other names
Methyl 3-oxo-2,3-dihydro-1H-indene-1-carboxylate, 97% (CAS 29427-70-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A128190-10g |
| cas | 29427-70-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10160.50 Pln | |
| Fluorochem | 100mg | 752.88 Pln | |
| Fluorochem | 250mg | 1205.84 Pln | |
| Fluorochem | 500mg | 1700.46 Pln | |
| Fluorochem | 1g | 2512.67 Pln | |
| Fluorochem | 5g | 7380.75 Pln | |
| Fluorochem | 10g | 12264.45 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-oxo-1,2-dihydroindene-1-carboxylate (CAS 29427-70-1) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: methyl 3-oxo-1,2-dihydroindene-1-carboxylate. InChIKey: HFFSDUMJDBSQKA-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | methyl 3-oxo-1,2-dihydroindene-1-carboxylate |
| InChIKey | HFFSDUMJDBSQKA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(=O)C2=CC=CC=C12 |
Computed by PubChem (NCBI)