cas: 149396-34-9 — see every product listed under this CAS number, including other names
Methyl 3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-8-carboxylate, 95%, 95% (CAS 149396-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112LO2-100mg |
| cas | 149396-34-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 894.80 Pln | |
| Chemat | 25g | 3059.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-oxo-4H-1,4-benzoxazine-8-carboxylate (CAS 149396-34-9) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: methyl 3-oxo-4H-1,4-benzoxazine-8-carboxylate. InChIKey: NIWLJRLGYZNNLM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | methyl 3-oxo-4H-1,4-benzoxazine-8-carboxylate |
| InChIKey | NIWLJRLGYZNNLM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C1)NC(=O)CO2 |
Computed by PubChem (NCBI)