cas: 149396-34-9 — see every product listed under this CAS number, including other names
methyl 3-oxo-3,4-dihydro-2H-1,4-benzoxazine-8-carboxylate, 96% (CAS 149396-34-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F357483-250MG |
| cas | 149396-34-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 518.59 Pln | |
| Fluorochem | 5g | 1565.09 Pln | |
| Fluorochem | 25g | 7484.88 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3-oxo-4H-1,4-benzoxazine-8-carboxylate (CAS 149396-34-9) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: methyl 3-oxo-4H-1,4-benzoxazine-8-carboxylate. InChIKey: NIWLJRLGYZNNLM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | methyl 3-oxo-4H-1,4-benzoxazine-8-carboxylate |
| InChIKey | NIWLJRLGYZNNLM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C1)NC(=O)CO2 |
Computed by PubChem (NCBI)