Methyl 3-phenylisoxazole-5-carboxylate, 97%
cas: 1081-30-7 — see every product listed under this CAS number, including other names
Methyl 3-phenylisoxazole-5-carboxylate, 97% (CAS 1081-30-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1197637-250mg |
| cas | 1081-30-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 971.12 Pln | |
| Ambeed | 10g | 1677.56 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 851.60 Pln | |
| Fluorochem | 1g | 518.59 Pln | |
| Fluorochem | 5g | 1580.71 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 1041.88 Pln | |
| BLDpharm | 10g | 1802.72 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 3-phenyl-1,2-oxazole-5-carboxylate (CAS 1081-30-7) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: methyl 3-phenyl-1,2-oxazole-5-carboxylate. InChIKey: SSDKYDGBJLXLAO-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | methyl 3-phenyl-1,2-oxazole-5-carboxylate |
| InChIKey | SSDKYDGBJLXLAO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NO1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)