cas: 5730-76-7 — see every product listed under this CAS number, including other names
Methyl 4'-amino-[1,1'-biphenyl]-4-carboxylate 98% (CAS 5730-76-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A230070-1g |
| cas | 5730-76-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 10g | 3185.00 Pln | |
| Ambeed | 25g | 6355.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A230070 |
Methyl 4-(4-aminophenyl)benzoate (CAS 5730-76-7) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: methyl 4-(4-aminophenyl)benzoate. InChIKey: KKPVZEJEFMQVSQ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | methyl 4-(4-aminophenyl)benzoate |
| InChIKey | KKPVZEJEFMQVSQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)