cas: 26791-93-5 — see every product listed under this CAS number, including other names
Methyl 4,5-dimethoxy-2-nitrobenzoate, 98%, 98% (CAS 26791-93-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118MQY-1g |
| cas | 26791-93-5 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 160.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4,5-dimethoxy-2-nitrobenzoate (CAS 26791-93-5) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: methyl 4,5-dimethoxy-2-nitrobenzoate. InChIKey: SYYKLKHBZGFKOC-UHFFFAOYSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | methyl 4,5-dimethoxy-2-nitrobenzoate |
| InChIKey | SYYKLKHBZGFKOC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)