cas: 64354-25-2 — see every product listed under this CAS number, including other names
Methyl 4,6-dibromo-5-hydroxypicolinate, 97%, 97% (CAS 64354-25-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKPJ-100mg |
| cas | 64354-25-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 520.40 Pln | |
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 500mg | 1091.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4,6-dibromo-5-hydroxypyridine-2-carboxylate (CAS 64354-25-2) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: methyl 4,6-dibromo-5-hydroxypyridine-2-carboxylate. InChIKey: OYLHPMFLGROSRR-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | methyl 4,6-dibromo-5-hydroxypyridine-2-carboxylate |
| InChIKey | OYLHPMFLGROSRR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C(=C1)Br)O)Br |
Computed by PubChem (NCBI)