cas: 1708251-14-2 — see every product listed under this CAS number, including other names
Methyl 4-((4-chlorobenzyl)oxy)thiophene-2-carboxylate 97% (CAS 1708251-14-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A424970-100mg |
| cas | 1708251-14-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1927.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A424970 |
Methyl 4-[(4-chlorophenyl)methoxy]thiophene-2-carboxylate (CAS 1708251-14-2) is a chemical compound with the molecular formula C13H11ClO3S and a molecular weight of 282.74 g/mol. IUPAC name: methyl 4-[(4-chlorophenyl)methoxy]thiophene-2-carboxylate. InChIKey: BPTONVPHSOATOI-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO3S |
|---|---|
| Molecular weight | 282.74 g/mol |
| IUPAC name | methyl 4-[(4-chlorophenyl)methoxy]thiophene-2-carboxylate |
| InChIKey | BPTONVPHSOATOI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CS1)OCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)