cas: 1416176-76-5 — see every product listed under this CAS number, including other names
Methyl 4-(benzyloxy)-2,5-difluorobenzoate (CAS 1416176-76-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630975-500MG |
| cas | 1416176-76-5 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 6735.15 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2,5-difluoro-4-phenylmethoxybenzoate (CAS 1416176-76-5) is a chemical compound with the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. IUPAC name: methyl 2,5-difluoro-4-phenylmethoxybenzoate. InChIKey: MQVBRJLWEIFCRO-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O3 |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | methyl 2,5-difluoro-4-phenylmethoxybenzoate |
| InChIKey | MQVBRJLWEIFCRO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)