CAS 1431533-45-7 is the registry number for Methyl 4-(benzyloxy)-3,5-difluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 3,5-difluoro-4-phenylmethoxybenzoate (CAS 1431533-45-7) is a chemical compound with the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. IUPAC name: methyl 3,5-difluoro-4-phenylmethoxybenzoate. InChIKey: FGSBWYBLOUDMTI-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O3 |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | methyl 3,5-difluoro-4-phenylmethoxybenzoate |
| InChIKey | FGSBWYBLOUDMTI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)F)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)