CAS 1879026-09-1 is the registry number for Methyl 4-(benzyloxy)-2,3-difluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
Methyl 2,3-difluoro-4-phenylmethoxybenzoate (CAS 1879026-09-1) is a chemical compound with the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. IUPAC name: methyl 2,3-difluoro-4-phenylmethoxybenzoate. InChIKey: NGNPMOWWMKAJIP-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O3 |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | methyl 2,3-difluoro-4-phenylmethoxybenzoate |
| InChIKey | NGNPMOWWMKAJIP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)OCC2=CC=CC=C2)F)F |
Computed by PubChem (NCBI)