CAS 2288708-86-9 appears in our catalog under these names: 2,6-Difluoro-4-[(4-methoxyphenyl)methoxy]benzaldehyde, 95%, 2,6-DIfluoro-4-((4-methoxyphenyl)methoxy)benzaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2,6-difluoro-4-[(4-methoxyphenyl)methoxy]benzaldehyde (CAS 2288708-86-9) is a chemical compound with the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. IUPAC name: 2,6-difluoro-4-[(4-methoxyphenyl)methoxy]benzaldehyde. InChIKey: BRVQFGTXMDUYLA-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O3 |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | 2,6-difluoro-4-[(4-methoxyphenyl)methoxy]benzaldehyde |
| InChIKey | BRVQFGTXMDUYLA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=CC(=C(C(=C2)F)C=O)F |
Computed by PubChem (NCBI)