Products 1993479-31-4
CAS 1993479-31-4 appears in our catalog under these names: Methyl 4-(benzyloxy)-2,6-difluorobenzoate, 98%, 4-Benzyloxy-2,6-difluorobenzoic acid methyl ester, 4-Benzyloxy-2,6-difluorobenzoic acid methyl ester, 95%, 4-Benzyloxy-2,6-difluorobenzoic acid methyl ester, ≥95%, ≥95%. Offered by: AmBeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg.
Methyl 2,6-difluoro-4-phenylmethoxybenzoate (CAS 1993479-31-4) is a chemical compound with the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. IUPAC name: methyl 2,6-difluoro-4-phenylmethoxybenzoate. InChIKey: FIWMTMDFAZWBQJ-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O3 |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | methyl 2,6-difluoro-4-phenylmethoxybenzoate |
| InChIKey | FIWMTMDFAZWBQJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)