cas: 1993479-31-4 — see every product listed under this CAS number, including other names
Methyl 4-(benzyloxy)-2,6-difluorobenzoate, 98% (CAS 1993479-31-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1637101-5g |
| cas | 1993479-31-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14118.58 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2,6-difluoro-4-phenylmethoxybenzoate (CAS 1993479-31-4) is a chemical compound with the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. IUPAC name: methyl 2,6-difluoro-4-phenylmethoxybenzoate. InChIKey: FIWMTMDFAZWBQJ-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O3 |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | methyl 2,6-difluoro-4-phenylmethoxybenzoate |
| InChIKey | FIWMTMDFAZWBQJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)