cas: 152628-01-8 — see every product listed under this CAS number, including other names
Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate, 97%, 97% (CAS 152628-01-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118JDY-250mg |
| cas | 152628-01-8 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 500g | 1108.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(butanoylamino)-3-methyl-5-nitrobenzoate (CAS 152628-01-8) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: methyl 4-(butanoylamino)-3-methyl-5-nitrobenzoate. InChIKey: IGCBUUTXGYCQAI-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | methyl 4-(butanoylamino)-3-methyl-5-nitrobenzoate |
| InChIKey | IGCBUUTXGYCQAI-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=C(C=C(C=C1C)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)