cas: 110654-40-5 — see every product listed under this CAS number, including other names
Methyl 4-(sulfamoylmethyl)benzoate 95% (CAS 110654-40-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A949493-250mg |
| cas | 110654-40-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 2356.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A949493 |
Methyl 4-(sulfamoylmethyl)benzoate (CAS 110654-40-5) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: methyl 4-(sulfamoylmethyl)benzoate. InChIKey: UUHYOFJXOUVLGG-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | methyl 4-(sulfamoylmethyl)benzoate |
| InChIKey | UUHYOFJXOUVLGG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CS(=O)(=O)N |
Computed by PubChem (NCBI)