cas: 42087-80-9 — see every product listed under this CAS number, including other names
Methyl 4-Chloro-2-Nitrobenzoate, 98%, 98% (CAS 42087-80-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZCA-5g |
| cas | 42087-80-9 |
| size | 5g |
| availability | 764.41g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 100g | 256.40 Pln | |
| Chemat | 500g | 936.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-chloro-2-nitrobenzoate (CAS 42087-80-9) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: methyl 4-chloro-2-nitrobenzoate. InChIKey: JWOSXVMUUBWGOL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | methyl 4-chloro-2-nitrobenzoate |
| InChIKey | JWOSXVMUUBWGOL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)