Methyl 4-amino-2-chloro-5-iodobenzoate, 98%
cas: 256935-85-0 — see every product listed under this CAS number, including other names
Methyl 4-amino-2-chloro-5-iodobenzoate, 98% (CAS 256935-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A791839-100mg |
| cas | 256935-85-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1788.81 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 1389.20 Pln | |
| Chemat | 10g | 2718.80 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 469.86 Pln | |
| BLDpharm | 5g | 1924.90 Pln | |
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1835.83 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-amino-2-chloro-5-iodobenzoate (CAS 256935-85-0) is a chemical compound with the molecular formula C8H7ClINO2 and a molecular weight of 311.50 g/mol. IUPAC name: methyl 4-amino-2-chloro-5-iodobenzoate. InChIKey: ACKIVQFMUDRNPN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClINO2 |
|---|---|
| Molecular weight | 311.50 g/mol |
| IUPAC name | methyl 4-amino-2-chloro-5-iodobenzoate |
| InChIKey | ACKIVQFMUDRNPN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)N)I |
Computed by PubChem (NCBI)