Products 1043870-58-1
CAS 1043870-58-1 is the registry number for Methyl 2-chloro-6-iodo-3-methyl-4-pyridinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-chloro-6-iodo-3-methylpyridine-4-carboxylate (CAS 1043870-58-1) is a chemical compound with the molecular formula C8H7ClINO2 and a molecular weight of 311.50 g/mol. IUPAC name: methyl 2-chloro-6-iodo-3-methylpyridine-4-carboxylate. InChIKey: ZBDLXUCRHRRXFN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClINO2 |
|---|---|
| Molecular weight | 311.50 g/mol |
| IUPAC name | methyl 2-chloro-6-iodo-3-methylpyridine-4-carboxylate |
| InChIKey | ZBDLXUCRHRRXFN-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C=C1C(=O)OC)I)Cl |
Computed by PubChem (NCBI)