Products 2044702-89-6
CAS 2044702-89-6 appears in our catalog under these names: Methyl 4–amino–3–(tert–butyl)benzoate hydrochloride, Methyl 4-amino-3-(tert-butyl)benzoate hydrochloride, 97%, 97%, Methyl 4-amino-3-(tert-butyl)benzoate hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 4-amino-3-tert-butylbenzoate;hydrochloride (CAS 2044702-89-6) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: methyl 4-amino-3-tert-butylbenzoate;hydrochloride. InChIKey: NAGQAJXQPQFSFT-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | methyl 4-amino-3-tert-butylbenzoate;hydrochloride |
| InChIKey | NAGQAJXQPQFSFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)