cas: 1807041-95-7 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-fluoro-3-hydroxybenzoate 95% (CAS 1807041-95-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A797904-250mg |
| cas | 1807041-95-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2022.44 Pln | |
| Ambeed | 25g | 5966.25 Pln | |
| Ambeed | 100g | 20968.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A797904 |
Methyl 4-bromo-2-fluoro-3-hydroxybenzoate (CAS 1807041-95-7) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: methyl 4-bromo-2-fluoro-3-hydroxybenzoate. InChIKey: XBHSVMMFEBLTBF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | methyl 4-bromo-2-fluoro-3-hydroxybenzoate |
| InChIKey | XBHSVMMFEBLTBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Br)O)F |
Computed by PubChem (NCBI)