Products 1426073-21-3
CAS 1426073-21-3 appears in our catalog under these names: 3-Bromo-6-fluoro-2-methoxybenzoic acid, 3-Bromo-6-fluoro-2-methoxybenzoic acid, 95%, 3-Bromo-6-fluoro-2-methoxybenzoic acid, 97%, 3-Bromo-6-fluoro-2-methoxybenzoic acid 95%, 3-Bromo-6-fluoro-2-methoxybenzoic acid, ≥95%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 2,5g, 5g, 10g, 1g, 25g, 100mg, 50mg.
3-bromo-6-fluoro-2-methoxybenzoic acid (CAS 1426073-21-3) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 3-bromo-6-fluoro-2-methoxybenzoic acid. InChIKey: WRSPJCQSBRAYCE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 3-bromo-6-fluoro-2-methoxybenzoic acid |
| InChIKey | WRSPJCQSBRAYCE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1C(=O)O)F)Br |
Computed by PubChem (NCBI)