CAS 1449008-25-6 appears in our catalog under these names: 3-Bromo-2-fluoro-6-methoxybenzoic acid, 3-Bromo-2-fluoro-6-methoxybenzoic acid, 95%, 3-Bromo-2-fluoro-6-methoxybenzoic acid 95%, 3-Bromo-2-fluoro-6-methoxybenzoic acid, 95%, 95%. Offered by: Biosynth, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 0,5g, 5g, 1g, 250mg, 10g, 25g.
3-bromo-2-fluoro-6-methoxybenzoic acid (CAS 1449008-25-6) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 3-bromo-2-fluoro-6-methoxybenzoic acid. InChIKey: WVIPJDXUWXKCBU-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 3-bromo-2-fluoro-6-methoxybenzoic acid |
| InChIKey | WVIPJDXUWXKCBU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)F)C(=O)O |
Computed by PubChem (NCBI)