cas: 1807041-95-7 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-fluoro-3-hydroxybenzoate, 96%, 96% (CAS 1807041-95-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I16Z-100mg |
| cas | 1807041-95-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 1432.40 Pln | |
| Chemat | 25g | 4581.20 Pln | |
| Chemat | 10g | 2296.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-2-fluoro-3-hydroxybenzoate (CAS 1807041-95-7) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: methyl 4-bromo-2-fluoro-3-hydroxybenzoate. InChIKey: XBHSVMMFEBLTBF-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | methyl 4-bromo-2-fluoro-3-hydroxybenzoate |
| InChIKey | XBHSVMMFEBLTBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Br)O)F |
Computed by PubChem (NCBI)