CAS 1260384-12-0 is the registry number for 2-Bromo-6-fluoro-4-methoxybenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g, 5g.
2-bromo-6-fluoro-4-methoxybenzoic acid (CAS 1260384-12-0) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 2-bromo-6-fluoro-4-methoxybenzoic acid. InChIKey: NTLWLHXBCMZHMM-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 2-bromo-6-fluoro-4-methoxybenzoic acid |
| InChIKey | NTLWLHXBCMZHMM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)C(=O)O)F |
Computed by PubChem (NCBI)