cas: 34126-16-4 — see every product listed under this CAS number, including other names
Methyl 4-bromo-3,5-dihydroxybenzoate, 98%, 98% (CAS 34126-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118HBU-100mg |
| cas | 34126-16-4 |
| size | 100mg |
| availability | 128g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 741.20 Pln | |
| Chemat | 25g | 1552.40 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-3,5-dihydroxybenzoate (CAS 34126-16-4) is a chemical compound with the molecular formula C8H7BrO4 and a molecular weight of 247.04 g/mol. IUPAC name: methyl 4-bromo-3,5-dihydroxybenzoate. InChIKey: UXSHRKILYILVSD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO4 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | methyl 4-bromo-3,5-dihydroxybenzoate |
| InChIKey | UXSHRKILYILVSD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)O)Br)O |
Computed by PubChem (NCBI)