Products 160911-19-3
CAS 160911-19-3 is the registry number for 4-Bromo-5-hydroxy-2-methoxybenzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-5-hydroxy-2-methoxybenzoic acid (CAS 160911-19-3) is a chemical compound with the molecular formula C8H7BrO4 and a molecular weight of 247.04 g/mol. IUPAC name: 4-bromo-5-hydroxy-2-methoxybenzoic acid. InChIKey: DNHWBNVSLXMDHH-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO4 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | 4-bromo-5-hydroxy-2-methoxybenzoic acid |
| InChIKey | DNHWBNVSLXMDHH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)O)Br |
Computed by PubChem (NCBI)