CAS 98437-43-5 appears in our catalog under these names: Methyl 5-bromo-2,4-dihydroxybenzoate 97%, Methyl 5-bromo-2,4-dihydroxybenzoate, 97%, Methyl 5-bromo-2,4-dihydroxybenzoate, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
Methyl 5-bromo-2,4-dihydroxybenzoate (CAS 98437-43-5) is a chemical compound with the molecular formula C8H7BrO4 and a molecular weight of 247.04 g/mol. IUPAC name: methyl 5-bromo-2,4-dihydroxybenzoate. InChIKey: MZVFWDFRPKIOEV-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO4 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | methyl 5-bromo-2,4-dihydroxybenzoate |
| InChIKey | MZVFWDFRPKIOEV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)O)Br |
Computed by PubChem (NCBI)