Products 34126-16-4
CAS 34126-16-4 appears in our catalog under these names: Methyl 4–bromo–3，5–dihydroxybenzoate, Methyl 4-bromo-3,5-dihydroxybenzoate, 98%, 4-Bromo-3,5-dihydroxybenzoic acid methyl ester, Methyl 4-bromo-3,5-dihydroxybenzoate, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Biosynth, Chemat. Available pack sizes: 250mg, 5g, 1g, 10g, 25g, 2g, 100mg, 50g.
Methyl 4-bromo-3,5-dihydroxybenzoate (CAS 34126-16-4) is a chemical compound with the molecular formula C8H7BrO4 and a molecular weight of 247.04 g/mol. IUPAC name: methyl 4-bromo-3,5-dihydroxybenzoate. InChIKey: UXSHRKILYILVSD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO4 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | methyl 4-bromo-3,5-dihydroxybenzoate |
| InChIKey | UXSHRKILYILVSD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)O)Br)O |
Computed by PubChem (NCBI)
Synonyms:
Benzoic acid, 4-bromo-3,5-dihydroxy-, methyl ester, 4-Bromo-3,5-dihydroxybenzoic acid, methyl ester, methyl 4-bromo-3,5-dihydroxybenzoate, methyl 4-bromo-3,5-dihydroxy-benzoate, 4-Bromo-3,5-dihydroxybenzoic acid methyl ester, methyl4-bromo-3,5-dihydroxybenzoate, 4-Bromo-3,5-dihydroxy-benzoic acid methyl ester