CAS 6324-52-3 appears in our catalog under these names: 3-Bromo-4-hydroxy-5-methoxybenzoic acid, 3-Bromo-4-hydroxy-5-methoxybenzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 250mg, 1g, 100mg, 5g, 10g.
3-bromo-4-hydroxy-5-methoxybenzoic acid (CAS 6324-52-3) is a chemical compound with the molecular formula C8H7BrO4 and a molecular weight of 247.04 g/mol. IUPAC name: 3-bromo-4-hydroxy-5-methoxybenzoic acid. InChIKey: FGOVBTMEPVEFCJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO4 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | 3-bromo-4-hydroxy-5-methoxybenzoic acid |
| InChIKey | FGOVBTMEPVEFCJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)Br)O |
Computed by PubChem (NCBI)