CAS 117738-74-6 appears in our catalog under these names: Methyl 4–Bromo–3–chlorobenzoate, Methyl 4-Bromo-3-chlorobenzoate, >96.0%(GC), Methyl 4-bromo-3-chlorobenzoate, 98%, 98%, Methyl 4-bromo-3-chlorobenzoate, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g, 10g.
Methyl 4-bromo-3-chlorobenzoate (CAS 117738-74-6) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: methyl 4-bromo-3-chlorobenzoate. InChIKey: BPJMNAWSHVKGHE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | methyl 4-bromo-3-chlorobenzoate |
| InChIKey | BPJMNAWSHVKGHE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)