cas: 1001336-16-8 — see every product listed under this CAS number, including other names
Methyl 4-chloro-2-formylbenzoate, 97% (CAS 1001336-16-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F612180-100MG |
| cas | 1001336-16-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1466.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-chloro-2-formylbenzoate (CAS 1001336-16-8) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: methyl 4-chloro-2-formylbenzoate. InChIKey: SXBBGDXVOZYMEK-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | methyl 4-chloro-2-formylbenzoate |
| InChIKey | SXBBGDXVOZYMEK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)C=O |
Computed by PubChem (NCBI)