cas: 1044920-98-0 — see every product listed under this CAS number, including other names
Methyl 4-chloro-3-formylbenzoate, 95%, 95% (CAS 1044920-98-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119Z52-100mg |
| cas | 1044920-98-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 462.80 Pln | |
| Chemat | 25g | 1984.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-chloro-3-formylbenzoate (CAS 1044920-98-0) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: methyl 4-chloro-3-formylbenzoate. InChIKey: SCKJKFNMDKHELA-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | methyl 4-chloro-3-formylbenzoate |
| InChIKey | SCKJKFNMDKHELA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Cl)C=O |
Computed by PubChem (NCBI)