cas: 648449-01-8 — see every product listed under this CAS number, including other names
Methyl 4-chloroquinoline-6-carboxylate, 97%, 97% (CAS 648449-01-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJVQ-10g |
| cas | 648449-01-8 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1514.00 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 928.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-chloroquinoline-6-carboxylate (CAS 648449-01-8) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: methyl 4-chloroquinoline-6-carboxylate. InChIKey: LGAFXSKTJPIZMQ-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | methyl 4-chloroquinoline-6-carboxylate |
| InChIKey | LGAFXSKTJPIZMQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CN=C2C=C1)Cl |
Computed by PubChem (NCBI)