cas: 648449-01-8 — see every product listed under this CAS number, including other names
Methyl 4–chloroquinoline–6–carboxylate (CAS 648449-01-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD17805-100mg |
| cas | 648449-01-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 512.79 Pln | |
| GLPBio | 1g | 952.76 Pln | |
| GLPBio | 250mg | 611.08 Pln | |
| GLPBio | 25g | 11984.70 Pln | |
| GLPBio | 5g | 2310.10 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 4-chloroquinoline-6-carboxylate (CAS 648449-01-8) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: methyl 4-chloroquinoline-6-carboxylate. InChIKey: LGAFXSKTJPIZMQ-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | methyl 4-chloroquinoline-6-carboxylate |
| InChIKey | LGAFXSKTJPIZMQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CN=C2C=C1)Cl |
Computed by PubChem (NCBI)