Methyl 4-chloroquinoline-6-carboxylate, 97%
cas: 648449-01-8 — see every product listed under this CAS number, including other names
Methyl 4-chloroquinoline-6-carboxylate, 97% (CAS 648449-01-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A248872-100mg |
| cas | 648449-01-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 342.56 Pln | |
| Ambeed | 5g | 1438.38 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 928.40 Pln | |
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 250mg | 181.07 Pln | |
| BLDpharm | 1g | 364.34 Pln | |
| BLDpharm | 5g | 1547.26 Pln | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 1429.72 Pln | |
| Fluorochem | 10g | 2767.79 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-chloroquinoline-6-carboxylate (CAS 648449-01-8) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: methyl 4-chloroquinoline-6-carboxylate. InChIKey: LGAFXSKTJPIZMQ-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | methyl 4-chloroquinoline-6-carboxylate |
| InChIKey | LGAFXSKTJPIZMQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CN=C2C=C1)Cl |
Computed by PubChem (NCBI)