CAS 69812-51-7 appears in our catalog under these names: 4–Chlorosulfonylbenzoic acid methyl ester, Methyl 4-(Chlorosulfonyl)benzoate, >98.0%(T), 4-Chlorosulfonylbenzoic acid methyl ester, 4-Chlorosulfonyl-benzoic acid methyl ester, 95%, Methyl 4-chlorosulfonylbenzoate, 93%. Offered by: GLPBio, TCI, Biosynth, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 10g, 100g, 50g, 250mg, 1g, 2.5g.
Methyl 4-chlorosulfonylbenzoate (CAS 69812-51-7) is a chemical compound with the molecular formula C8H7ClO4S and a molecular weight of 234.66 g/mol. IUPAC name: methyl 4-chlorosulfonylbenzoate. InChIKey: MOFQDKOKODUZPK-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | methyl 4-chlorosulfonylbenzoate |
| InChIKey | MOFQDKOKODUZPK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)