CAS 1104561-82-1 appears in our catalog under these names: 2-Chloro-6-(Methylsulfonyl) Benzoic Acid, 2-Chloro-6-methanesulfonylbenzoic acid, 95%, 2-Chloro-6-methanesulfonylbenzoic acid. Offered by: Chemat Brand, AmBeed, Biosynth. Available pack sizes: on request, 1g, 0,5g, 50mg.
2-chloro-6-methylsulfonylbenzoic acid (CAS 1104561-82-1) is a chemical compound with the molecular formula C8H7ClO4S and a molecular weight of 234.66 g/mol. IUPAC name: 2-chloro-6-methylsulfonylbenzoic acid. InChIKey: MPTKGIVXPPZDLY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | 2-chloro-6-methylsulfonylbenzoic acid |
| InChIKey | MPTKGIVXPPZDLY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)