Products 1197193-45-5
CAS 1197193-45-5 appears in our catalog under these names: 3-Chloro-4-(methylsulfonyl)benzoic acid, 98%, 3-chloro-4-methanesulfonylbenzoic acid, 3-Chloro-4-(methylsulfonyl)-benzoic Acid, 3–Chloro–4–(methylsulfonyl)benzoic Acid, 3-Chloro-4-(methylsulfonyl)benzoic acid, 95%+, 95%+. Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed, GLPBio. Available pack sizes: 10g, 5g, 25g, 1g, on request, 100mg, 250mg.
3-chloro-4-methylsulfonylbenzoic acid (CAS 1197193-45-5) is a chemical compound with the molecular formula C8H7ClO4S and a molecular weight of 234.66 g/mol. IUPAC name: 3-chloro-4-methylsulfonylbenzoic acid. InChIKey: HBBPBQPKQRWCBA-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | 3-chloro-4-methylsulfonylbenzoic acid |
| InChIKey | HBBPBQPKQRWCBA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)