CAS 89001-57-0 appears in our catalog under these names: 5–(Chlorosulfonyl)–2–methylbenzoic acid, 5-(Chlorosulfonyl)-2-methylbenzoic acid 95%, 5-(Chlorosulfonyl)-2-Methylbenzoic Acid, 95%, 95%, 5-(Chlorosulfonyl)-2-methylbenzoic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g.
5-chlorosulfonyl-2-methylbenzoic acid (CAS 89001-57-0) is a chemical compound with the molecular formula C8H7ClO4S and a molecular weight of 234.66 g/mol. IUPAC name: 5-chlorosulfonyl-2-methylbenzoic acid. InChIKey: FMWIOAWRARBKDQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | 5-chlorosulfonyl-2-methylbenzoic acid |
| InChIKey | FMWIOAWRARBKDQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)