CAS 2548-29-0 appears in our catalog under these names: 3-Chlorosulfonyl-4-methyl-benzoic acid, 98%, 3–Chlorosulfonyl–4–methylbenzoic acid, 3-Chlorosulfonyl-4-methylbenzoic acid 98%, 3-Chlorosulfonyl-4-methylbenzoic acid, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 100g, 10g, 5g, 25g, 1g.
3-chlorosulfonyl-4-methylbenzoic acid (CAS 2548-29-0) is a chemical compound with the molecular formula C8H7ClO4S and a molecular weight of 234.66 g/mol. IUPAC name: 3-chlorosulfonyl-4-methylbenzoic acid. InChIKey: XVAASXODNQTGCP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | 3-chlorosulfonyl-4-methylbenzoic acid |
| InChIKey | XVAASXODNQTGCP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)