cas: 1246223-44-8 — see every product listed under this CAS number, including other names
Methyl 4-chlorothieno(3,2-d)pyrimidine-7-carboxylate, 95+% (CAS 1246223-44-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A639826-5g |
| cas | 1246223-44-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14287.84 Pln | |
| AmBeed | 100mg | 838.18 Pln | |
| AmBeed | 10g | 17275.93 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 4-chlorothieno[3,2-d]pyrimidine-7-carboxylate (CAS 1246223-44-8) is a chemical compound with the molecular formula C8H5ClN2O2S and a molecular weight of 228.66 g/mol. IUPAC name: methyl 4-chlorothieno[3,2-d]pyrimidine-7-carboxylate. InChIKey: FIRXDNARXSAIRC-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2S |
|---|---|
| Molecular weight | 228.66 g/mol |
| IUPAC name | methyl 4-chlorothieno[3,2-d]pyrimidine-7-carboxylate |
| InChIKey | FIRXDNARXSAIRC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC2=C1N=CN=C2Cl |
Computed by PubChem (NCBI)