Products 1896666-65-1
CAS 1896666-65-1 is the registry number for Methyl 2-chlorothieno[2,3-d]pyrimidine-6-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 2-chlorothieno[2,3-d]pyrimidine-6-carboxylate (CAS 1896666-65-1) is a chemical compound with the molecular formula C8H5ClN2O2S and a molecular weight of 228.66 g/mol. IUPAC name: methyl 2-chlorothieno[2,3-d]pyrimidine-6-carboxylate. InChIKey: HIIRZXXVFFTQJV-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2S |
|---|---|
| Molecular weight | 228.66 g/mol |
| IUPAC name | methyl 2-chlorothieno[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | HIIRZXXVFFTQJV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CN=C(N=C2S1)Cl |
Computed by PubChem (NCBI)