CAS 1188375-25-8 is the registry number for 5-(5-Chloro-thiophen-2-yl)-2H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-(5-chlorothiophen-2-yl)-1H-pyrazole-3-carboxylic acid (CAS 1188375-25-8) is a chemical compound with the molecular formula C8H5ClN2O2S and a molecular weight of 228.66 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-1H-pyrazole-3-carboxylic acid. InChIKey: GYIXQBMJJZNZJW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2S |
|---|---|
| Molecular weight | 228.66 g/mol |
| IUPAC name | 5-(5-chlorothiophen-2-yl)-1H-pyrazole-3-carboxylic acid |
| InChIKey | GYIXQBMJJZNZJW-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)C2=CC(=NN2)C(=O)O |
Computed by PubChem (NCBI)