Products 1188375-25-8

CAS 1188375-25-8 is the registry number for 5-(5-Chloro-thiophen-2-yl)-2H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-(5-chlorothiophen-2-yl)-1H-pyrazole-3-carboxylic acid (CAS 1188375-25-8) is a chemical compound with the molecular formula C8H5ClN2O2S and a molecular weight of 228.66 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-1H-pyrazole-3-carboxylic acid. InChIKey: GYIXQBMJJZNZJW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClN2O2S
Molecular weight228.66 g/mol
IUPAC name5-(5-chlorothiophen-2-yl)-1H-pyrazole-3-carboxylic acid
InChIKeyGYIXQBMJJZNZJW-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)Cl)C2=CC(=NN2)C(=O)O

Computed by PubChem (NCBI)