CAS 5264-77-7 is the registry number for 5-Chloro-2-methyl-6-nitrobenzo(d)thiazole, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
5-chloro-2-methyl-6-nitro-1,3-benzothiazole (CAS 5264-77-7) is a chemical compound with the molecular formula C8H5ClN2O2S and a molecular weight of 228.66 g/mol. IUPAC name: 5-chloro-2-methyl-6-nitro-1,3-benzothiazole. InChIKey: HCIFTTCECGSAPA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2S |
|---|---|
| Molecular weight | 228.66 g/mol |
| IUPAC name | 5-chloro-2-methyl-6-nitro-1,3-benzothiazole |
| InChIKey | HCIFTTCECGSAPA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2S1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)