CAS 1379302-45-0 appears in our catalog under these names: Methyl 4-chlorothieno(3,2-d)pyrimidine-2-carboxylate, 95+%, Methyl 4-chlorothieno(3,2-d)pyrimidine-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 4-chlorothieno[3,2-d]pyrimidine-2-carboxylate (CAS 1379302-45-0) is a chemical compound with the molecular formula C8H5ClN2O2S and a molecular weight of 228.66 g/mol. IUPAC name: methyl 4-chlorothieno[3,2-d]pyrimidine-2-carboxylate. InChIKey: FVJHQTIEVGKCCG-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2S |
|---|---|
| Molecular weight | 228.66 g/mol |
| IUPAC name | methyl 4-chlorothieno[3,2-d]pyrimidine-2-carboxylate |
| InChIKey | FVJHQTIEVGKCCG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(C(=N1)Cl)SC=C2 |
Computed by PubChem (NCBI)